C16H30O9 — CID 11474039
(E,3S,4S,7S,9R)-9-hydroxy-3,4,7-tris(methoxymethoxy)dec-5-enoic acid (PubChem CID 11474039) has the molecular formula C16H30O9 and a molecular weight of 366.41 g/mol. Its IUPAC name is (E,3S,4S,7S,9R)-9-hydroxy-3,4,7-tris(methoxymethoxy)dec-5-enoic acid.
| Compound Name | (E,3S,4S,7S,9R)-9-hydroxy-3,4,7-tris(methoxymethoxy)dec-5-enoic acid |
|---|---|
| PubChem CID | 11474039 |
| Molecular Formula | C16H30O9 |
| Molecular Weight | 366.41 g/mol |
| Exact Mass | 366.19 |
| IUPAC Name | (E,3S,4S,7S,9R)-9-hydroxy-3,4,7-tris(methoxymethoxy)dec-5-enoic acid |
| SMILES | COCO[C@H](/C=C/[C@H](OCOC)[C@H](CC(=O)O)OCOC)C[C@@H](C)O |
| InChI | InChI=1S/C16H30O9/c1-12(17)7-13(23-9-20-2)5-6-14(24-10-21-3)15(8-16(18)19)25-11-22-4/h5-6,12-15,17H,7-11H2,1-4H3,(H,18,19)/b6-5+/t12-,13-,14+,15+/m1/s1 |
| InChIKey | OFRJCYOUSSYEBM-FHSIOMNJSA-N |
| XLogP | 0.76 |
| TPSA | 112.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.41 |
| LogP ≤ 5 | 0.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|