C12H18O6 — CID 90689868
methyl 2-[(2R,3S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]acetate (PubChem CID 90689868) has the molecular formula C12H18O6 and a molecular weight of 258.27 g/mol. Its IUPAC name is methyl 2-[(2R,3S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]acetate.
| Compound Name | methyl 2-[(2R,3S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]acetate |
|---|---|
| PubChem CID | 90689868 |
| Molecular Formula | C12H18O6 |
| Molecular Weight | 258.27 g/mol |
| Exact Mass | 258.11 |
| IUPAC Name | methyl 2-[(2R,3S)-3-acetyloxy-6-ethoxy-3,6-dihydro-2H-pyran-2-yl]acetate |
| SMILES | CCOC1C=C[C@H](OC(C)=O)[C@@H](CC(=O)OC)O1 |
| InChI | InChI=1S/C12H18O6/c1-4-16-12-6-5-9(17-8(2)13)10(18-12)7-11(14)15-3/h5-6,9-10,12H,4,7H2,1-3H3/t9-,10+,12?/m0/s1 |
| InChIKey | QVJKGWMBBUJYRV-YPBKCWQDSA-N |
| XLogP | 0.80 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.27 |
| LogP ≤ 5 | 0.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|