C16H28O8 — CID 11302480
(2R,4S,5E,7S,8S)-4,7,8-tris(methoxymethoxy)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one (PubChem CID 11302480) has the molecular formula C16H28O8 and a molecular weight of 348.39 g/mol. Its IUPAC name is (2R,4S,5E,7S,8S)-4,7,8-tris(methoxymethoxy)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one.
| Compound Name | (2R,4S,5E,7S,8S)-4,7,8-tris(methoxymethoxy)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
|---|---|
| PubChem CID | 11302480 |
| Molecular Formula | C16H28O8 |
| Molecular Weight | 348.39 g/mol |
| Exact Mass | 348.18 |
| IUPAC Name | (2R,4S,5E,7S,8S)-4,7,8-tris(methoxymethoxy)-2-methyl-2,3,4,7,8,9-hexahydrooxecin-10-one |
| SMILES | COCO[C@@H]1/C=C/[C@H](OCOC)[C@@H](OCOC)CC(=O)O[C@H](C)C1 |
| InChI | InChI=1S/C16H28O8/c1-12-7-13(21-9-18-2)5-6-14(22-10-19-3)15(23-11-20-4)8-16(17)24-12/h5-6,12-15H,7-11H2,1-4H3/b6-5+/t12-,13-,14+,15+/m1/s1 |
| InChIKey | DCPZKGPVAITOCT-FHSIOMNJSA-N |
| XLogP | 1.24 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 348.39 |
| LogP ≤ 5 | 1.24 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|