C14H26O7 — CID 11001267
(E,3R,6S,9R)-9-hydroxy-3,6-bis(methoxymethoxy)dec-4-enoic acid (PubChem CID 11001267) has the molecular formula C14H26O7 and a molecular weight of 306.36 g/mol. Its IUPAC name is (E,3R,6S,9R)-9-hydroxy-3,6-bis(methoxymethoxy)dec-4-enoic acid.
| Compound Name | (E,3R,6S,9R)-9-hydroxy-3,6-bis(methoxymethoxy)dec-4-enoic acid |
|---|---|
| PubChem CID | 11001267 |
| Molecular Formula | C14H26O7 |
| Molecular Weight | 306.36 g/mol |
| Exact Mass | 306.17 |
| IUPAC Name | (E,3R,6S,9R)-9-hydroxy-3,6-bis(methoxymethoxy)dec-4-enoic acid |
| SMILES | COCO[C@H](/C=C/[C@@H](CC(=O)O)OCOC)CC[C@@H](C)O |
| InChI | InChI=1S/C14H26O7/c1-11(15)4-5-12(20-9-18-2)6-7-13(8-14(16)17)21-10-19-3/h6-7,11-13,15H,4-5,8-10H2,1-3H3,(H,16,17)/b7-6+/t11-,12+,13+/m1/s1 |
| InChIKey | DBQHQYAOSLDNMY-LQVFNYONSA-N |
| XLogP | 1.16 |
| TPSA | 94.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 306.36 |
| LogP ≤ 5 | 1.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|