C16H26O5 — CID 135028300
[(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl] (4R)-4-hydroxyhex-5-enoate (PubChem CID 135028300) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl] (4R)-4-hydroxyhex-5-enoate.
| Compound Name | [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl] (4R)-4-hydroxyhex-5-enoate |
|---|---|
| PubChem CID | 135028300 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | [(1S)-1-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]propyl] (4R)-4-hydroxyhex-5-enoate |
| SMILES | C=C[C@H](O)CCC(=O)O[C@@H](CC)[C@@H]1OC(C)(C)O[C@@H]1C=C |
| InChI | InChI=1S/C16H26O5/c1-6-11(17)9-10-14(18)19-12(7-2)15-13(8-3)20-16(4,5)21-15/h6,8,11-13,15,17H,1,3,7,9-10H2,2,4-5H3/t11-,12-,13+,15-/m0/s1 |
| InChIKey | KTNQEMJMTARLMI-XPCVCDNBSA-N |
| XLogP | 2.34 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|