C16H26O5 — CID 135028051
(3aS,4S,9R,10E,11aR)-4-butyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one (PubChem CID 135028051) has the molecular formula C16H26O5 and a molecular weight of 298.38 g/mol. Its IUPAC name is (3aS,4S,9R,10E,11aR)-4-butyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one.
| Compound Name | (3aS,4S,9R,10E,11aR)-4-butyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
|---|---|
| PubChem CID | 135028051 |
| Molecular Formula | C16H26O5 |
| Molecular Weight | 298.38 g/mol |
| Exact Mass | 298.18 |
| IUPAC Name | (3aS,4S,9R,10E,11aR)-4-butyl-9-hydroxy-2,2-dimethyl-3a,4,7,8,9,11a-hexahydro-[1,3]dioxolo[4,5-c]oxecin-6-one |
| SMILES | CCCC[C@@H]1OC(=O)CC[C@@H](O)/C=C/[C@H]2OC(C)(C)O[C@@H]12 |
| InChI | InChI=1S/C16H26O5/c1-4-5-6-12-15-13(20-16(2,3)21-15)9-7-11(17)8-10-14(18)19-12/h7,9,11-13,15,17H,4-6,8,10H2,1-3H3/b9-7+/t11-,12-,13+,15-/m0/s1 |
| InChIKey | RHJMNNIMOCDBCY-SEXHNHCMSA-N |
| XLogP | 2.32 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 298.38 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|