C16H30O5Si — CID 71551018
(4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid (PubChem CID 71551018) has the molecular formula C16H30O5Si and a molecular weight of 330.50 g/mol. Its IUPAC name is (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid.
| Compound Name | (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
|---|---|
| PubChem CID | 71551018 |
| Molecular Formula | C16H30O5Si |
| Molecular Weight | 330.50 g/mol |
| Exact Mass | 330.19 |
| IUPAC Name | (4S,5S)-5-[(1R)-1-[tert-butyl(dimethyl)silyl]oxy-2-methylprop-2-enyl]-2,2-dimethyl-1,3-dioxolane-4-carboxylic acid |
| SMILES | C=C(C)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1OC(C)(C)O[C@@H]1C(=O)O |
| InChI | InChI=1S/C16H30O5Si/c1-10(2)11(21-22(8,9)15(3,4)5)12-13(14(17)18)20-16(6,7)19-12/h11-13H,1H2,2-9H3,(H,17,18)/t11-,12-,13+/m1/s1 |
| InChIKey | LMYAFZTUGUZQOM-UPJWGTAASA-N |
| XLogP | 3.56 |
| TPSA | 64.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.50 |
| LogP ≤ 5 | 3.56 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|