C10H14O5 — CID 101136281
(2S,3R)-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxylic acid (PubChem CID 101136281) has the molecular formula C10H14O5 and a molecular weight of 214.22 g/mol. Its IUPAC name is (2S,3R)-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxylic acid.
| Compound Name | (2S,3R)-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxylic acid |
|---|---|
| PubChem CID | 101136281 |
| Molecular Formula | C10H14O5 |
| Molecular Weight | 214.22 g/mol |
| Exact Mass | 214.08 |
| IUPAC Name | (2S,3R)-3-[(4S,5R)-5-ethenyl-2,2-dimethyl-1,3-dioxolan-4-yl]oxirane-2-carboxylic acid |
| SMILES | C=C[C@H]1OC(C)(C)O[C@@H]1[C@H]1O[C@@H]1C(=O)O |
| InChI | InChI=1S/C10H14O5/c1-4-5-6(15-10(2,3)14-5)7-8(13-7)9(11)12/h4-8H,1H2,2-3H3,(H,11,12)/t5-,6+,7-,8+/m1/s1 |
| InChIKey | DQGKSEXHBKVLGY-CWKFCGSDSA-N |
| XLogP | 0.54 |
| TPSA | 68.29 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.22 |
| LogP ≤ 5 | 0.54 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|