C29H62O6Si3 — CID 11135683
(E,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoic acid (PubChem CID 11135683) has the molecular formula C29H62O6Si3 and a molecular weight of 591.07 g/mol. Its IUPAC name is (E,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoic acid.
| Compound Name | (E,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoic acid |
|---|---|
| PubChem CID | 11135683 |
| Molecular Formula | C29H62O6Si3 |
| Molecular Weight | 591.07 g/mol |
| Exact Mass | 590.39 |
| IUPAC Name | (E,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoic acid |
| SMILES | CO[C@H](C(=O)O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C/C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C29H62O6Si3/c1-21(2)19-20-22(33-36(13,14)27(3,4)5)23(34-37(15,16)28(6,7)8)24(25(32-12)26(30)31)35-38(17,18)29(9,10)11/h19-25H,1-18H3,(H,30,31)/b20-19+/t22-,23+,24-,25-/m0/s1 |
| InChIKey | UGIRTLSAHUZPLL-IKUYACHNSA-N |
| XLogP | 8.47 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.07 |
| LogP ≤ 5 | 8.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|