C30H64O6Si3 — CID 11006552
methyl (Z,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoate (PubChem CID 11006552) has the molecular formula C30H64O6Si3 and a molecular weight of 605.09 g/mol. Its IUPAC name is methyl (Z,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoate.
| Compound Name | methyl (Z,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoate |
|---|---|
| PubChem CID | 11006552 |
| Molecular Formula | C30H64O6Si3 |
| Molecular Weight | 605.09 g/mol |
| Exact Mass | 604.40 |
| IUPAC Name | methyl (Z,2S,3R,4R,5S)-3,4,5-tris[[tert-butyl(dimethyl)silyl]oxy]-2-methoxy-8-methylnon-6-enoate |
| SMILES | COC(=O)[C@@H](OC)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H](/C=C\C(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H64O6Si3/c1-22(2)20-21-23(34-37(14,15)28(3,4)5)24(35-38(16,17)29(6,7)8)25(26(32-12)27(31)33-13)36-39(18,19)30(9,10)11/h20-26H,1-19H3/b21-20-/t23-,24+,25-,26-/m0/s1 |
| InChIKey | YFHZXUQYSKETKU-JBFGAALXSA-N |
| XLogP | 8.56 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 605.09 |
| LogP ≤ 5 | 8.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|