C41H76O5Si3 — CID 132574608
methyl (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-tris[[tert-butyl(dimethyl)silyl]oxy]docosa-6,8,10,13,15,19-hexaenoate (PubChem CID 132574608) has the molecular formula C41H76O5Si3 and a molecular weight of 733.31 g/mol. Its IUPAC name is methyl (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-tris[[tert-butyl(dimethyl)silyl]oxy]docosa-6,8,10,13,15,19-hexaenoate.
| Compound Name | methyl (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-tris[[tert-butyl(dimethyl)silyl]oxy]docosa-6,8,10,13,15,19-hexaenoate |
|---|---|
| PubChem CID | 132574608 |
| Molecular Formula | C41H76O5Si3 |
| Molecular Weight | 733.31 g/mol |
| Exact Mass | 732.50 |
| IUPAC Name | methyl (4S,5R,6E,8E,10Z,13Z,15E,17S,19Z)-4,5,17-tris[[tert-butyl(dimethyl)silyl]oxy]docosa-6,8,10,13,15,19-hexaenoate |
| SMILES | CC/C=C\C[C@@H](/C=C/C=C\C/C=C\C=C\C=C\[C@@H](O[Si](C)(C)C(C)(C)C)[C@H](CCC(=O)OC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C41H76O5Si3/c1-18-19-27-30-35(44-47(12,13)39(2,3)4)31-28-25-23-21-20-22-24-26-29-32-36(45-48(14,15)40(5,6)7)37(33-34-38(42)43-11)46-49(16,17)41(8,9)10/h19-20,22-29,31-32,35-37H,18,21,30,33-34H2,1-17H3/b22-20-,25-23-,26-24+,27-19-,31-28+,32-29+/t35-,36+,37-/m0/s1 |
| InChIKey | UPCZZJVFKNDJIY-NXLUNSMISA-N |
| XLogP | 12.64 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 20 |
| Heavy Atoms | 49 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 733.31 |
| LogP ≤ 5 | 12.64 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|