C26H46O7Si — CID 102190488
[(1R)-4-ethoxy-2,4-dioxo-1-[(2S,6S)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butyl] 2,2-dimethylpropanoate (PubChem CID 102190488) has the molecular formula C26H46O7Si and a molecular weight of 498.73 g/mol. Its IUPAC name is [(1R)-4-ethoxy-2,4-dioxo-1-[(2S,6S)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butyl] 2,2-dimethylpropanoate.
| Compound Name | [(1R)-4-ethoxy-2,4-dioxo-1-[(2S,6S)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butyl] 2,2-dimethylpropanoate |
|---|---|
| PubChem CID | 102190488 |
| Molecular Formula | C26H46O7Si |
| Molecular Weight | 498.73 g/mol |
| Exact Mass | 498.30 |
| IUPAC Name | [(1R)-4-ethoxy-2,4-dioxo-1-[(2S,6S)-2-[tri(propan-2-yl)silyloxymethyl]-3,6-dihydro-2H-pyran-6-yl]butyl] 2,2-dimethylpropanoate |
| SMILES | CCOC(=O)CC(=O)[C@H](OC(=O)C(C)(C)C)[C@@H]1C=CC[C@@H](CO[Si](C(C)C)(C(C)C)C(C)C)O1 |
| InChI | InChI=1S/C26H46O7Si/c1-11-30-23(28)15-21(27)24(33-25(29)26(8,9)10)22-14-12-13-20(32-22)16-31-34(17(2)3,18(4)5)19(6)7/h12,14,17-20,22,24H,11,13,15-16H2,1-10H3/t20-,22-,24-/m0/s1 |
| InChIKey | KCWLPNBZQVGGOW-SSPYTLHUSA-N |
| XLogP | 5.37 |
| TPSA | 88.13 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.73 |
| LogP ≤ 5 | 5.37 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|