C30H56O8Si2 — CID 24770705
[(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate (PubChem CID 24770705) has the molecular formula C30H56O8Si2 and a molecular weight of 600.94 g/mol. Its IUPAC name is [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate.
| Compound Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
|---|---|
| PubChem CID | 24770705 |
| Molecular Formula | C30H56O8Si2 |
| Molecular Weight | 600.94 g/mol |
| Exact Mass | 600.35 |
| IUPAC Name | [(2S,3R)-3-[tert-butyl(dimethyl)silyl]oxypent-4-en-2-yl] (4R,5S)-4-[tert-butyl(dimethyl)silyl]oxy-5-[(3R)-3-prop-2-enoyloxybutanoyl]oxyhexanoate |
| SMILES | C=CC(=O)O[C@H](C)CC(=O)O[C@@H](C)[C@@H](CCC(=O)O[C@@H](C)[C@@H](C=C)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H56O8Si2/c1-16-24(37-39(12,13)29(6,7)8)22(4)35-27(32)19-18-25(38-40(14,15)30(9,10)11)23(5)36-28(33)20-21(3)34-26(31)17-2/h16-17,21-25H,1-2,18-20H2,3-15H3/t21-,22+,23+,24-,25-/m1/s1 |
| InChIKey | CNPQQNXTXVCKMF-ZLOLNMDISA-N |
| XLogP | 7.10 |
| TPSA | 97.36 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 600.94 |
| LogP ≤ 5 | 7.10 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|