C27H56O4SiSn — CID 50901589
methyl (E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-tributylstannylhept-6-enoate (PubChem CID 50901589) has the molecular formula C27H56O4SiSn and a molecular weight of 591.54 g/mol. Its IUPAC name is methyl (E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-tributylstannylhept-6-enoate.
| Compound Name | methyl (E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-tributylstannylhept-6-enoate |
|---|---|
| PubChem CID | 50901589 |
| Molecular Formula | C27H56O4SiSn |
| Molecular Weight | 591.54 g/mol |
| Exact Mass | 592.30 |
| IUPAC Name | methyl (E,3S,5R)-3-[tert-butyl(dimethyl)silyl]oxy-5-methoxy-7-tributylstannylhept-6-enoate |
| SMILES | CCCC[Sn](/C=C/[C@@H](C[C@@H](CC(=O)OC)O[Si](C)(C)C(C)(C)C)OC)(CCCC)CCCC |
| InChI | InChI=1S/C15H29O4Si.3C4H9.Sn/c1-9-12(17-5)10-13(11-14(16)18-6)19-20(7,8)15(2,3)4;3*1-3-4-2;/h1,9,12-13H,10-11H2,2-8H3;3*1,3-4H2,2H3;/t12-,13-;;;;/m0..../s1 |
| InChIKey | DBJBBYVLARZCDW-FDUIRRPTSA-N |
| XLogP | 8.29 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 591.54 |
| LogP ≤ 5 | 8.29 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|