3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid

C19H40O4Si2 — CID 11058201

IUPAC3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid
SMILESC=CC(CC(CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C19H40O4Si2/c1-12-15(22-24(8,9)18(2,3)4)13-16(14-17(20)21)23-25(10,11)19(5,6)7/h12,15-16H,1,13-14H2,2-11H3,(H,20,21)
InChIKeyZEOAKHINMWGBTN-UHFFFAOYSA-N
MW388.70 g/mol
LogP5.82
Rot. Bonds9

About 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid

3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid (PubChem CID 11058201) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid.

Molecular Properties

Compound Name3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid
PubChem CID11058201
Molecular FormulaC19H40O4Si2
Molecular Weight388.70 g/mol
Exact Mass388.25
IUPAC Name3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid
SMILESC=CC(CC(CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C19H40O4Si2/c1-12-15(22-24(8,9)18(2,3)4)13-16(14-17(20)21)23-25(10,11)19(5,6)7/h12,15-16H,1,13-14H2,2-11H3,(H,20,21)
InChIKeyZEOAKHINMWGBTN-UHFFFAOYSA-N
XLogP5.82
TPSA55.76 Ų
H-Bond Donors1
H-Bond Acceptors3
Rotatable Bonds9
Heavy Atoms25
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500388.70
LogP ≤ 55.82
H-Bond Donors ≤ 51
H-Bond Acceptors ≤ 103

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid?
The IUPAC name of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid (CID 11058201) is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid.
What is the SMILES notation for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid?
The canonical SMILES for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid is C=CC(CC(CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid?
The InChIKey is ZEOAKHINMWGBTN-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H40O4Si2/c1-12-15(22-24(8,9)18(2,3)4)13-16(14-17(20)21)23-25(10,11)19(5,6)7/h12,15-16H,1,13-14H2,2-11H3,(H,20,21).
What are the key properties of 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid?
3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid has a molecular weight of 388.70 g/mol, XLogP of 5.82, 9 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid is sourced from PubChem (CID 11058201), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).