C19H40O4Si2 — CID 11058201
3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid (PubChem CID 11058201) has the molecular formula C19H40O4Si2 and a molecular weight of 388.70 g/mol. Its IUPAC name is 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid.
| Compound Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid |
|---|---|
| PubChem CID | 11058201 |
| Molecular Formula | C19H40O4Si2 |
| Molecular Weight | 388.70 g/mol |
| Exact Mass | 388.25 |
| IUPAC Name | 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoic acid |
| SMILES | C=CC(CC(CC(=O)O)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C19H40O4Si2/c1-12-15(22-24(8,9)18(2,3)4)13-16(14-17(20)21)23-25(10,11)19(5,6)7/h12,15-16H,1,13-14H2,2-11H3,(H,20,21) |
| InChIKey | ZEOAKHINMWGBTN-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 388.70 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|