ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate

C21H44O4Si2 — CID 85350934

IUPACethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate
SMILESC=CC(CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C21H44O4Si2/c1-13-17(24-26(9,10)20(3,4)5)15-18(16-19(22)23-14-2)25-27(11,12)21(6,7)8/h13,17-18H,1,14-16H2,2-12H3
InChIKeyVOSKGMRUVCNWKF-UHFFFAOYSA-N
MW416.75 g/mol
LogP6.30
Rot. Bonds10

About ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate

ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate (PubChem CID 85350934) has the molecular formula C21H44O4Si2 and a molecular weight of 416.75 g/mol. Its IUPAC name is ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate.

Molecular Properties

Compound Nameethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate
PubChem CID85350934
Molecular FormulaC21H44O4Si2
Molecular Weight416.75 g/mol
Exact Mass416.28
IUPAC Nameethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate
SMILESC=CC(CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C
InChIInChI=1S/C21H44O4Si2/c1-13-17(24-26(9,10)20(3,4)5)15-18(16-19(22)23-14-2)25-27(11,12)21(6,7)8/h13,17-18H,1,14-16H2,2-12H3
InChIKeyVOSKGMRUVCNWKF-UHFFFAOYSA-N
XLogP6.30
TPSA44.76 Ų
H-Bond Donors
H-Bond Acceptors4
Rotatable Bonds10
Heavy Atoms27
Complexity

Lipinski Rule of Five

1 violation

RuleValue
MW ≤ 500416.75
LogP ≤ 56.30
H-Bond Donors ≤ 50
H-Bond Acceptors ≤ 104

Computed Properties (RDKit)

Structural Alerts{'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}

Analyze ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate with MolForge

Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.

Launch Full Analysis

Frequently Asked Questions

What is the IUPAC name of ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate?
The IUPAC name of ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate (CID 85350934) is ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate.
What is the SMILES notation for ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate?
The canonical SMILES for ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate is C=CC(CC(CC(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C.
What is the InChIKey of ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate?
The InChIKey is VOSKGMRUVCNWKF-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H44O4Si2/c1-13-17(24-26(9,10)20(3,4)5)15-18(16-19(22)23-14-2)25-27(11,12)21(6,7)8/h13,17-18H,1,14-16H2,2-12H3.
What are the key properties of ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate?
ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate has a molecular weight of 416.75 g/mol, XLogP of 6.30, 10 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3,5-bis[[tert-butyl(dimethyl)silyl]oxy]hept-6-enoate is sourced from PubChem (CID 85350934), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).