C20H42O4Si2 — CID 11682821
(2S,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhept-6-enoic acid (PubChem CID 11682821) has the molecular formula C20H42O4Si2 and a molecular weight of 402.72 g/mol. Its IUPAC name is (2S,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhept-6-enoic acid.
| Compound Name | (2S,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhept-6-enoic acid |
|---|---|
| PubChem CID | 11682821 |
| Molecular Formula | C20H42O4Si2 |
| Molecular Weight | 402.72 g/mol |
| Exact Mass | 402.26 |
| IUPAC Name | (2S,3S,5S)-3,5-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylhept-6-enoic acid |
| SMILES | C=C[C@H](C[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)C(=O)O)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C20H42O4Si2/c1-13-16(23-25(9,10)19(3,4)5)14-17(15(2)18(21)22)24-26(11,12)20(6,7)8/h13,15-17H,1,14H2,2-12H3,(H,21,22)/t15-,16+,17-/m0/s1 |
| InChIKey | QWOVEPHXTZTBLD-BBWFWOEESA-N |
| XLogP | 6.06 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 402.72 |
| LogP ≤ 5 | 6.06 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|