C15H29IO4Si — CID 155934416
methyl (E,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-iodo-2-methylhept-6-enoate (PubChem CID 155934416) has the molecular formula C15H29IO4Si and a molecular weight of 428.38 g/mol. Its IUPAC name is methyl (E,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-iodo-2-methylhept-6-enoate.
| Compound Name | methyl (E,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-iodo-2-methylhept-6-enoate |
|---|---|
| PubChem CID | 155934416 |
| Molecular Formula | C15H29IO4Si |
| Molecular Weight | 428.38 g/mol |
| Exact Mass | 428.09 |
| IUPAC Name | methyl (E,2R,3R,5S)-5-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-iodo-2-methylhept-6-enoate |
| SMILES | COC(=O)[C@H](C)[C@H](O)C[C@@H](/C=C/I)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C15H29IO4Si/c1-11(14(18)19-5)13(17)10-12(8-9-16)20-21(6,7)15(2,3)4/h8-9,11-13,17H,10H2,1-7H3/b9-8+/t11-,12-,13-/m1/s1 |
| InChIKey | GNPXTDPUUFSFPI-UVPOXWBHSA-N |
| XLogP | 3.89 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 428.38 |
| LogP ≤ 5 | 3.89 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|