C17H31IO4Si — CID 50915519
(2R,3R,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methoxy-2-methylnona-6,8-dienoic acid (PubChem CID 50915519) has the molecular formula C17H31IO4Si and a molecular weight of 454.42 g/mol. Its IUPAC name is (2R,3R,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methoxy-2-methylnona-6,8-dienoic acid.
| Compound Name | (2R,3R,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methoxy-2-methylnona-6,8-dienoic acid |
|---|---|
| PubChem CID | 50915519 |
| Molecular Formula | C17H31IO4Si |
| Molecular Weight | 454.42 g/mol |
| Exact Mass | 454.10 |
| IUPAC Name | (2R,3R,5R,6E,8E)-5-[tert-butyl(dimethyl)silyl]oxy-9-iodo-3-methoxy-2-methylnona-6,8-dienoic acid |
| SMILES | CO[C@H](C[C@H](/C=C/C=C/I)O[Si](C)(C)C(C)(C)C)[C@@H](C)C(=O)O |
| InChI | InChI=1S/C17H31IO4Si/c1-13(16(19)20)15(21-5)12-14(10-8-9-11-18)22-23(6,7)17(2,3)4/h8-11,13-15H,12H2,1-7H3,(H,19,20)/b10-8+,11-9+/t13-,14+,15-/m1/s1 |
| InChIKey | LONNCWJOIFSGHA-YTQRWKNZSA-N |
| XLogP | 5.01 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 454.42 |
| LogP ≤ 5 | 5.01 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|