C17H34O4Si — CID 10449334
tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-6-enoate (PubChem CID 10449334) has the molecular formula C17H34O4Si and a molecular weight of 330.54 g/mol. Its IUPAC name is tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-6-enoate.
| Compound Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-6-enoate |
|---|---|
| PubChem CID | 10449334 |
| Molecular Formula | C17H34O4Si |
| Molecular Weight | 330.54 g/mol |
| Exact Mass | 330.22 |
| IUPAC Name | tert-butyl 3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxyhept-6-enoate |
| SMILES | C=CC(O)CC(CC(=O)OC(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C17H34O4Si/c1-10-13(18)11-14(12-15(19)20-16(2,3)4)21-22(8,9)17(5,6)7/h10,13-14,18H,1,11-12H2,2-9H3 |
| InChIKey | YPHJSQUPBXBMRN-UHFFFAOYSA-N |
| XLogP | 4.05 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 330.54 |
| LogP ≤ 5 | 4.05 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|