C14H27IO4Si — CID 71746314
methyl (E,3S,5R)-3-hydroxy-7-iodo-5-triethylsilyloxyhept-6-enoate (PubChem CID 71746314) has the molecular formula C14H27IO4Si and a molecular weight of 414.36 g/mol. Its IUPAC name is methyl (E,3S,5R)-3-hydroxy-7-iodo-5-triethylsilyloxyhept-6-enoate.
| Compound Name | methyl (E,3S,5R)-3-hydroxy-7-iodo-5-triethylsilyloxyhept-6-enoate |
|---|---|
| PubChem CID | 71746314 |
| Molecular Formula | C14H27IO4Si |
| Molecular Weight | 414.36 g/mol |
| Exact Mass | 414.07 |
| IUPAC Name | methyl (E,3S,5R)-3-hydroxy-7-iodo-5-triethylsilyloxyhept-6-enoate |
| SMILES | CC[Si](CC)(CC)O[C@@H](/C=C/I)C[C@H](O)CC(=O)OC |
| InChI | InChI=1S/C14H27IO4Si/c1-5-20(6-2,7-3)19-13(8-9-15)10-12(16)11-14(17)18-4/h8-9,12-13,16H,5-7,10-11H2,1-4H3/b9-8+/t12-,13-/m0/s1 |
| InChIKey | VJWLRDCEKZJNAQ-TYDXBBDOSA-N |
| XLogP | 3.64 |
| TPSA | 55.76 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.36 |
| LogP ≤ 5 | 3.64 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|