C23H46O5Si2 — CID 11091763
ethyl 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxonon-8-enoate (PubChem CID 11091763) has the molecular formula C23H46O5Si2 and a molecular weight of 458.79 g/mol. Its IUPAC name is ethyl 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxonon-8-enoate.
| Compound Name | ethyl 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxonon-8-enoate |
|---|---|
| PubChem CID | 11091763 |
| Molecular Formula | C23H46O5Si2 |
| Molecular Weight | 458.79 g/mol |
| Exact Mass | 458.29 |
| IUPAC Name | ethyl 5,7-bis[[tert-butyl(dimethyl)silyl]oxy]-3-oxonon-8-enoate |
| SMILES | C=CC(CC(CC(=O)CC(=O)OCC)O[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H46O5Si2/c1-13-19(27-29(9,10)22(3,4)5)17-20(28-30(11,12)23(6,7)8)15-18(24)16-21(25)26-14-2/h13,19-20H,1,14-17H2,2-12H3 |
| InChIKey | QPMXXXWRQVIGTO-UHFFFAOYSA-N |
| XLogP | 6.26 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 458.79 |
| LogP ≤ 5 | 6.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|