C22H38O6Si — CID 56590301
[(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-3,3-dimethyl-4-oxohept-6-en-2-yl] acetate (PubChem CID 56590301) has the molecular formula C22H38O6Si and a molecular weight of 426.63 g/mol. Its IUPAC name is [(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-3,3-dimethyl-4-oxohept-6-en-2-yl] acetate.
| Compound Name | [(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-3,3-dimethyl-4-oxohept-6-en-2-yl] acetate |
|---|---|
| PubChem CID | 56590301 |
| Molecular Formula | C22H38O6Si |
| Molecular Weight | 426.63 g/mol |
| Exact Mass | 426.24 |
| IUPAC Name | [(2S)-1-[(2S,4R)-4-[tert-butyl(dimethyl)silyl]oxy-6-oxooxan-2-yl]-3,3-dimethyl-4-oxohept-6-en-2-yl] acetate |
| SMILES | C=CCC(=O)C(C)(C)[C@H](C[C@H]1C[C@@H](O[Si](C)(C)C(C)(C)C)CC(=O)O1)OC(C)=O |
| InChI | InChI=1S/C22H38O6Si/c1-10-11-18(24)22(6,7)19(26-15(2)23)13-16-12-17(14-20(25)27-16)28-29(8,9)21(3,4)5/h10,16-17,19H,1,11-14H2,2-9H3/t16-,17-,19+/m1/s1 |
| InChIKey | JGBPWXUVZPDNER-LMMKCTJWSA-N |
| XLogP | 4.58 |
| TPSA | 78.90 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 426.63 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|