C25H50O4Si2 — CID 25186476
(4R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-(3-methylbut-3-enyl)oxan-2-one (PubChem CID 25186476) has the molecular formula C25H50O4Si2 and a molecular weight of 470.84 g/mol. Its IUPAC name is (4R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-(3-methylbut-3-enyl)oxan-2-one.
| Compound Name | (4R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-(3-methylbut-3-enyl)oxan-2-one |
|---|---|
| PubChem CID | 25186476 |
| Molecular Formula | C25H50O4Si2 |
| Molecular Weight | 470.84 g/mol |
| Exact Mass | 470.32 |
| IUPAC Name | (4R,5S)-5-[(1S)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]propyl]-4-(3-methylbut-3-enyl)oxan-2-one |
| SMILES | C=C(C)CC[C@@H]1CC(=O)OC[C@H]1[C@H](CCO[Si](C)(C)C(C)(C)C)O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C25H50O4Si2/c1-19(2)13-14-20-17-23(26)27-18-21(20)22(29-31(11,12)25(6,7)8)15-16-28-30(9,10)24(3,4)5/h20-22H,1,13-18H2,2-12H3/t20-,21-,22+/m1/s1 |
| InChIKey | ICAZWNKJHIYKGY-VSKRKVRLSA-N |
| XLogP | 7.32 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 470.84 |
| LogP ≤ 5 | 7.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|