C35H68O3SiSn — CID 138981339
(4R,6S)-4-[(E)-2-tributylstannylethenyl]-6-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]oxan-2-one (PubChem CID 138981339) has the molecular formula C35H68O3SiSn and a molecular weight of 683.72 g/mol. Its IUPAC name is (4R,6S)-4-[(E)-2-tributylstannylethenyl]-6-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]oxan-2-one.
| Compound Name | (4R,6S)-4-[(E)-2-tributylstannylethenyl]-6-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]oxan-2-one |
|---|---|
| PubChem CID | 138981339 |
| Molecular Formula | C35H68O3SiSn |
| Molecular Weight | 683.72 g/mol |
| Exact Mass | 684.40 |
| IUPAC Name | (4R,6S)-4-[(E)-2-tributylstannylethenyl]-6-[(2R,3R)-3-tri(propan-2-yl)silyloxyhept-6-en-2-yl]oxan-2-one |
| SMILES | C=CCC[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](C)[C@@H]1C[C@@H](/C=C/[Sn](CCCC)(CCCC)CCCC)CC(=O)O1 |
| InChI | InChI=1S/C23H41O3Si.3C4H9.Sn/c1-10-12-13-21(26-27(16(3)4,17(5)6)18(7)8)19(9)22-14-20(11-2)15-23(24)25-22;3*1-3-4-2;/h2,10-11,16-22H,1,12-15H2,3-9H3;3*1,3-4H2,2H3;/t19-,20+,21+,22-;;;;/m0..../s1 |
| InChIKey | ZCPYLHHGTMPSQR-LWULZNSHSA-N |
| XLogP | 11.42 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 21 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 683.72 |
| LogP ≤ 5 | 11.42 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|