C24H48O3Si — CID 10764187
tert-butyl (6R,9S)-9-[diethyl(propan-2-yl)silyl]oxy-6-methyldodec-11-enoate (PubChem CID 10764187) has the molecular formula C24H48O3Si and a molecular weight of 412.73 g/mol. Its IUPAC name is tert-butyl (6R,9S)-9-[diethyl(propan-2-yl)silyl]oxy-6-methyldodec-11-enoate.
| Compound Name | tert-butyl (6R,9S)-9-[diethyl(propan-2-yl)silyl]oxy-6-methyldodec-11-enoate |
|---|---|
| PubChem CID | 10764187 |
| Molecular Formula | C24H48O3Si |
| Molecular Weight | 412.73 g/mol |
| Exact Mass | 412.34 |
| IUPAC Name | tert-butyl (6R,9S)-9-[diethyl(propan-2-yl)silyl]oxy-6-methyldodec-11-enoate |
| SMILES | C=CC[C@H](CC[C@H](C)CCCCC(=O)OC(C)(C)C)O[Si](CC)(CC)C(C)C |
| InChI | InChI=1S/C24H48O3Si/c1-10-15-22(27-28(11-2,12-3)20(4)5)19-18-21(6)16-13-14-17-23(25)26-24(7,8)9/h10,20-22H,1,11-19H2,2-9H3/t21-,22-/m1/s1 |
| InChIKey | YHXVBTGETJBKOV-FGZHOGPDSA-N |
| XLogP | 7.66 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 412.73 |
| LogP ≤ 5 | 7.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|