C30H54O5Si — CID 72700970
(1S,6S,9R,13R,14Z,17R,19S)-14-[diethoxy(methyl)silyl]-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one (PubChem CID 72700970) has the molecular formula C30H54O5Si and a molecular weight of 522.84 g/mol. Its IUPAC name is (1S,6S,9R,13R,14Z,17R,19S)-14-[diethoxy(methyl)silyl]-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one.
| Compound Name | (1S,6S,9R,13R,14Z,17R,19S)-14-[diethoxy(methyl)silyl]-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one |
|---|---|
| PubChem CID | 72700970 |
| Molecular Formula | C30H54O5Si |
| Molecular Weight | 522.84 g/mol |
| Exact Mass | 522.37 |
| IUPAC Name | (1S,6S,9R,13R,14Z,17R,19S)-14-[diethoxy(methyl)silyl]-6,13,19-trimethyl-11-methylidene-9-propyl-8,20-dioxabicyclo[15.2.1]icos-14-en-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@@H](C/C=C(\[Si](C)(OCC)OCC)[C@H](C)C1)C[C@@H]2C |
| InChI | InChI=1S/C30H54O5Si/c1-9-14-26-20-22(4)19-25(7)29(36(8,32-10-2)33-11-3)18-17-27-21-24(6)28(34-27)16-13-12-15-23(5)30(31)35-26/h18,23-28H,4,9-17,19-21H2,1-3,5-8H3/b29-18-/t23-,24-,25+,26+,27-,28-/m0/s1 |
| InChIKey | TWYVYQKWCHRXPT-QKWWVTDUSA-N |
| XLogP | 7.68 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 522.84 |
| LogP ≤ 5 | 7.68 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|