C37H72O5Si2 — CID 135021871
(1S,6S,9R,13R,14S,15S,17R,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-14,15-bis(triethylsilyloxy)-8,20-dioxabicyclo[15.2.1]icosan-7-one (PubChem CID 135021871) has the molecular formula C37H72O5Si2 and a molecular weight of 653.15 g/mol. Its IUPAC name is (1S,6S,9R,13R,14S,15S,17R,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-14,15-bis(triethylsilyloxy)-8,20-dioxabicyclo[15.2.1]icosan-7-one.
| Compound Name | (1S,6S,9R,13R,14S,15S,17R,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-14,15-bis(triethylsilyloxy)-8,20-dioxabicyclo[15.2.1]icosan-7-one |
|---|---|
| PubChem CID | 135021871 |
| Molecular Formula | C37H72O5Si2 |
| Molecular Weight | 653.15 g/mol |
| Exact Mass | 652.49 |
| IUPAC Name | (1S,6S,9R,13R,14S,15S,17R,19S)-6,13,19-trimethyl-11-methylidene-9-propyl-14,15-bis(triethylsilyloxy)-8,20-dioxabicyclo[15.2.1]icosan-7-one |
| SMILES | C=C1C[C@@H](CCC)OC(=O)[C@@H](C)CCCC[C@@H]2O[C@@H](C[C@H](O[Si](CC)(CC)CC)[C@@H](O[Si](CC)(CC)CC)[C@H](C)C1)C[C@@H]2C |
| InChI | InChI=1S/C37H72O5Si2/c1-12-21-32-25-28(8)24-31(11)36(42-44(16-5,17-6)18-7)35(41-43(13-2,14-3)15-4)27-33-26-30(10)34(39-33)23-20-19-22-29(9)37(38)40-32/h29-36H,8,12-27H2,1-7,9-11H3/t29-,30-,31+,32+,33+,34-,35-,36-/m0/s1 |
| InChIKey | AERDUSHDEPMDDX-CKEWZNFZSA-N |
| XLogP | 10.85 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 44 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 653.15 |
| LogP ≤ 5 | 10.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|