C21H36O3Si — CID 11667718
(4S,5R)-5-[(1S)-2-methylidenecyclopentyl]-4-[(1S)-3-methyl-1-triethylsilyloxybut-3-enyl]oxolan-2-one (PubChem CID 11667718) has the molecular formula C21H36O3Si and a molecular weight of 364.60 g/mol. Its IUPAC name is (4S,5R)-5-[(1S)-2-methylidenecyclopentyl]-4-[(1S)-3-methyl-1-triethylsilyloxybut-3-enyl]oxolan-2-one.
| Compound Name | (4S,5R)-5-[(1S)-2-methylidenecyclopentyl]-4-[(1S)-3-methyl-1-triethylsilyloxybut-3-enyl]oxolan-2-one |
|---|---|
| PubChem CID | 11667718 |
| Molecular Formula | C21H36O3Si |
| Molecular Weight | 364.60 g/mol |
| Exact Mass | 364.24 |
| IUPAC Name | (4S,5R)-5-[(1S)-2-methylidenecyclopentyl]-4-[(1S)-3-methyl-1-triethylsilyloxybut-3-enyl]oxolan-2-one |
| SMILES | C=C(C)C[C@H](O[Si](CC)(CC)CC)[C@H]1CC(=O)O[C@@H]1[C@H]1CCCC1=C |
| InChI | InChI=1S/C21H36O3Si/c1-7-25(8-2,9-3)24-19(13-15(4)5)18-14-20(22)23-21(18)17-12-10-11-16(17)6/h17-19,21H,4,6-14H2,1-3,5H3/t17-,18+,19-,21+/m0/s1 |
| InChIKey | XJWAWZAXHHMTFU-YOUFYPILSA-N |
| XLogP | 5.63 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 25 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 364.60 |
| LogP ≤ 5 | 5.63 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|