C19H36O3Si — CID 10759622
(3S,4R,5R)-3-methyl-4-prop-1-en-2-yl-5-[2-tri(propan-2-yl)silyloxyethyl]oxolan-2-one (PubChem CID 10759622) has the molecular formula C19H36O3Si and a molecular weight of 340.58 g/mol. Its IUPAC name is (3S,4R,5R)-3-methyl-4-prop-1-en-2-yl-5-[2-tri(propan-2-yl)silyloxyethyl]oxolan-2-one.
| Compound Name | (3S,4R,5R)-3-methyl-4-prop-1-en-2-yl-5-[2-tri(propan-2-yl)silyloxyethyl]oxolan-2-one |
|---|---|
| PubChem CID | 10759622 |
| Molecular Formula | C19H36O3Si |
| Molecular Weight | 340.58 g/mol |
| Exact Mass | 340.24 |
| IUPAC Name | (3S,4R,5R)-3-methyl-4-prop-1-en-2-yl-5-[2-tri(propan-2-yl)silyloxyethyl]oxolan-2-one |
| SMILES | C=C(C)[C@H]1[C@H](C)C(=O)O[C@@H]1CCO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C19H36O3Si/c1-12(2)18-16(9)19(20)22-17(18)10-11-21-23(13(3)4,14(5)6)15(7)8/h13-18H,1,10-11H2,2-9H3/t16-,17+,18-/m0/s1 |
| InChIKey | ZTWZWEVNMVAPOS-KSZLIROESA-N |
| XLogP | 5.32 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 340.58 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|