C17H26O2Si — CID 135016355
(3S,3aR,7S,7aR)-3-but-3-en-2-yl-4-ethenyl-7-trimethylsilyl-3a,6,7,7a-tetrahydro-3H-1-benzofuran-2-one (PubChem CID 135016355) has the molecular formula C17H26O2Si and a molecular weight of 290.48 g/mol. Its IUPAC name is (3S,3aR,7S,7aR)-3-but-3-en-2-yl-4-ethenyl-7-trimethylsilyl-3a,6,7,7a-tetrahydro-3H-1-benzofuran-2-one.
| Compound Name | (3S,3aR,7S,7aR)-3-but-3-en-2-yl-4-ethenyl-7-trimethylsilyl-3a,6,7,7a-tetrahydro-3H-1-benzofuran-2-one |
|---|---|
| PubChem CID | 135016355 |
| Molecular Formula | C17H26O2Si |
| Molecular Weight | 290.48 g/mol |
| Exact Mass | 290.17 |
| IUPAC Name | (3S,3aR,7S,7aR)-3-but-3-en-2-yl-4-ethenyl-7-trimethylsilyl-3a,6,7,7a-tetrahydro-3H-1-benzofuran-2-one |
| SMILES | C=CC1=CC[C@H]([Si](C)(C)C)[C@@H]2OC(=O)[C@@H](C(C)C=C)[C@H]12 |
| InChI | InChI=1S/C17H26O2Si/c1-7-11(3)14-15-12(8-2)9-10-13(20(4,5)6)16(15)19-17(14)18/h7-9,11,13-16H,1-2,10H2,3-6H3/t11?,13-,14-,15-,16-/m0/s1 |
| InChIKey | WILQJIZNHINWMX-CSBJFYKXSA-N |
| XLogP | 4.19 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.48 |
| LogP ≤ 5 | 4.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|