C17H28O2Si — CID 134948532
(3aR,7aR)-7,7-dimethyl-3a-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]-4,5,6,7a-tetrahydro-3H-2-benzofuran-1-one (PubChem CID 134948532) has the molecular formula C17H28O2Si and a molecular weight of 292.50 g/mol. Its IUPAC name is (3aR,7aR)-7,7-dimethyl-3a-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]-4,5,6,7a-tetrahydro-3H-2-benzofuran-1-one.
| Compound Name | (3aR,7aR)-7,7-dimethyl-3a-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]-4,5,6,7a-tetrahydro-3H-2-benzofuran-1-one |
|---|---|
| PubChem CID | 134948532 |
| Molecular Formula | C17H28O2Si |
| Molecular Weight | 292.50 g/mol |
| Exact Mass | 292.19 |
| IUPAC Name | (3aR,7aR)-7,7-dimethyl-3a-[(1E,3E)-4-trimethylsilylbuta-1,3-dienyl]-4,5,6,7a-tetrahydro-3H-2-benzofuran-1-one |
| SMILES | CC1(C)CCC[C@]2(/C=C/C=C/[Si](C)(C)C)COC(=O)[C@H]12 |
| InChI | InChI=1S/C17H28O2Si/c1-16(2)9-8-11-17(13-19-15(18)14(16)17)10-6-7-12-20(3,4)5/h6-7,10,12,14H,8-9,11,13H2,1-5H3/b10-6+,12-7+/t14-,17-/m1/s1 |
| InChIKey | PZUOGLMPDRQCES-MFTSKPHTSA-N |
| XLogP | 4.35 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.50 |
| LogP ≤ 5 | 4.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|