C19H28O2 — CID 162992325
(3aS,7Z,7aS)-7-ethylidene-6-[(1R)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1-one (PubChem CID 162992325) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3aS,7Z,7aS)-7-ethylidene-6-[(1R)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aS,7Z,7aS)-7-ethylidene-6-[(1R)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 162992325 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3aS,7Z,7aS)-7-ethylidene-6-[(1R)-1,3,3-trimethylcyclohexyl]-3,3a,4,7a-tetrahydro-2-benzofuran-1-one |
| SMILES | C/C=C1\C([C@]2(C)CCCC(C)(C)C2)=CC[C@@H]2COC(=O)[C@H]12 |
| InChI | InChI=1S/C19H28O2/c1-5-14-15(8-7-13-11-21-17(20)16(13)14)19(4)10-6-9-18(2,3)12-19/h5,8,13,16H,6-7,9-12H2,1-4H3/b14-5+/t13-,16+,19-/m1/s1 |
| InChIKey | JYGCZJWYAJTITQ-DODVQYCISA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |