C15H22O3 — CID 137321633
(3aS,5R,7aR)-5-hydroxy-5-(1-methylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one (PubChem CID 137321633) has the molecular formula C15H22O3 and a molecular weight of 250.34 g/mol. Its IUPAC name is (3aS,5R,7aR)-5-hydroxy-5-(1-methylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one.
| Compound Name | (3aS,5R,7aR)-5-hydroxy-5-(1-methylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 137321633 |
| Molecular Formula | C15H22O3 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.16 |
| IUPAC Name | (3aS,5R,7aR)-5-hydroxy-5-(1-methylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-2-benzofuran-1-one |
| SMILES | CC1([C@@]2(O)CC[C@H]3C(=O)OC[C@H]3C2)C=CCCC1 |
| InChI | InChI=1S/C15H22O3/c1-14(6-3-2-4-7-14)15(17)8-5-12-11(9-15)10-18-13(12)16/h3,6,11-12,17H,2,4-5,7-10H2,1H3/t11-,12-,14?,15-/m1/s1 |
| InChIKey | JRYNIGOWZHQIFS-MYIUUGPWSA-N |
| XLogP | 2.44 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|