C17H28O2 — CID 156693396
(3aR,5S,7aS)-5-(1,5,5-trimethylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-ol (PubChem CID 156693396) has the molecular formula C17H28O2 and a molecular weight of 264.41 g/mol. Its IUPAC name is (3aR,5S,7aS)-5-(1,5,5-trimethylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-ol.
| Compound Name | (3aR,5S,7aS)-5-(1,5,5-trimethylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-ol |
|---|---|
| PubChem CID | 156693396 |
| Molecular Formula | C17H28O2 |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.21 |
| IUPAC Name | (3aR,5S,7aS)-5-(1,5,5-trimethylcyclohex-2-en-1-yl)-3,3a,4,6,7,7a-hexahydro-1H-2-benzofuran-5-ol |
| SMILES | CC1(C)CC=CC(C)([C@]2(O)CC[C@@H]3COC[C@@H]3C2)C1 |
| InChI | InChI=1S/C17H28O2/c1-15(2)6-4-7-16(3,12-15)17(18)8-5-13-10-19-11-14(13)9-17/h4,7,13-14,18H,5-6,8-12H2,1-3H3/t13-,14+,16?,17+/m1/s1 |
| InChIKey | JVVWQFURNBVZEH-ADZQQQBPSA-N |
| XLogP | 3.55 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 3.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|