C18H28O3 — CID 139673390
7a-dec-1-enyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione (PubChem CID 139673390) has the molecular formula C18H28O3 and a molecular weight of 292.42 g/mol. Its IUPAC name is 7a-dec-1-enyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione.
| Compound Name | 7a-dec-1-enyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
|---|---|
| PubChem CID | 139673390 |
| Molecular Formula | C18H28O3 |
| Molecular Weight | 292.42 g/mol |
| Exact Mass | 292.20 |
| IUPAC Name | 7a-dec-1-enyl-4,5,6,7-tetrahydro-3aH-2-benzofuran-1,3-dione |
| SMILES | CCCCCCCCC=CC12CCCCC1C(=O)OC2=O |
| InChI | InChI=1S/C18H28O3/c1-2-3-4-5-6-7-8-10-13-18-14-11-9-12-15(18)16(19)21-17(18)20/h10,13,15H,2-9,11-12,14H2,1H3 |
| InChIKey | JMCJDBRPVUVIFE-UHFFFAOYSA-N |
| XLogP | 4.55 |
| TPSA | 43.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 292.42 |
| LogP ≤ 5 | 4.55 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|