C16H24O2Si — CID 101424369
(3aS,7aR)-6-trimethylsilylspiro[3a,7a-dihydro-1-benzofuran-3,1'-cyclohexane]-2-one (PubChem CID 101424369) has the molecular formula C16H24O2Si and a molecular weight of 276.45 g/mol. Its IUPAC name is (3aS,7aR)-6-trimethylsilylspiro[3a,7a-dihydro-1-benzofuran-3,1'-cyclohexane]-2-one.
| Compound Name | (3aS,7aR)-6-trimethylsilylspiro[3a,7a-dihydro-1-benzofuran-3,1'-cyclohexane]-2-one |
|---|---|
| PubChem CID | 101424369 |
| Molecular Formula | C16H24O2Si |
| Molecular Weight | 276.45 g/mol |
| Exact Mass | 276.15 |
| IUPAC Name | (3aS,7aR)-6-trimethylsilylspiro[3a,7a-dihydro-1-benzofuran-3,1'-cyclohexane]-2-one |
| SMILES | C[Si](C)(C)C1=C[C@@H]2OC(=O)C3(CCCCC3)[C@@H]2C=C1 |
| InChI | InChI=1S/C16H24O2Si/c1-19(2,3)12-7-8-13-14(11-12)18-15(17)16(13)9-5-4-6-10-16/h7-8,11,13-14H,4-6,9-10H2,1-3H3/t13-,14+/m1/s1 |
| InChIKey | NGKNWNJNGFOLIE-KGLIPLIRSA-N |
| XLogP | 3.85 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 276.45 |
| LogP ≤ 5 | 3.85 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|