C19H28O2 — CID 163109822
(3aR,4Z,7aR)-4-ethylidene-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,7,7a-tetrahydro-2-benzofuran-1-one (PubChem CID 163109822) has the molecular formula C19H28O2 and a molecular weight of 288.43 g/mol. Its IUPAC name is (3aR,4Z,7aR)-4-ethylidene-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,7,7a-tetrahydro-2-benzofuran-1-one.
| Compound Name | (3aR,4Z,7aR)-4-ethylidene-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,7,7a-tetrahydro-2-benzofuran-1-one |
|---|---|
| PubChem CID | 163109822 |
| Molecular Formula | C19H28O2 |
| Molecular Weight | 288.43 g/mol |
| Exact Mass | 288.21 |
| IUPAC Name | (3aR,4Z,7aR)-4-ethylidene-5-[(1S)-1,3,3-trimethylcyclohexyl]-3,3a,7,7a-tetrahydro-2-benzofuran-1-one |
| SMILES | C/C=C1\C([C@@]2(C)CCCC(C)(C)C2)=CC[C@H]2C(=O)OC[C@@H]12 |
| InChI | InChI=1S/C19H28O2/c1-5-13-15-11-21-17(20)14(15)7-8-16(13)19(4)10-6-9-18(2,3)12-19/h5,8,14-15H,6-7,9-12H2,1-4H3/b13-5-/t14-,15+,19+/m1/s1 |
| InChIKey | IRRQWUGRWFZORI-NPXWZVJESA-N |
| XLogP | 4.66 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.43 |
| LogP ≤ 5 | 4.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |