C42H86O5Si2Sn — CID 11768053
methyl (3R,5S,6S,7R)-6-methyl-11-oxo-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundecanoate (PubChem CID 11768053) has the molecular formula C42H86O5Si2Sn and a molecular weight of 846.03 g/mol. Its IUPAC name is methyl (3R,5S,6S,7R)-6-methyl-11-oxo-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundecanoate.
| Compound Name | methyl (3R,5S,6S,7R)-6-methyl-11-oxo-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundecanoate |
|---|---|
| PubChem CID | 11768053 |
| Molecular Formula | C42H86O5Si2Sn |
| Molecular Weight | 846.03 g/mol |
| Exact Mass | 846.50 |
| IUPAC Name | methyl (3R,5S,6S,7R)-6-methyl-11-oxo-3-[(E)-2-tributylstannylethenyl]-5-triethylsilyloxy-7-tri(propan-2-yl)silyloxyundecanoate |
| SMILES | CCCC[Sn](/C=C/C(CC(=O)OC)C[C@H](O[Si](CC)(CC)CC)[C@@H](C)[C@@H](CCCC=O)O[Si](C(C)C)(C(C)C)C(C)C)(CCCC)CCCC |
| InChI | InChI=1S/C30H59O5Si2.3C4H9.Sn/c1-13-27(22-30(32)33-12)21-29(34-36(14-2,15-3)16-4)26(11)28(19-17-18-20-31)35-37(23(5)6,24(7)8)25(9)10;3*1-3-4-2;/h1,13,20,23-29H,14-19,21-22H2,2-12H3;3*1,3-4H2,2H3;/t26-,27?,28+,29-;;;;/m0..../s1 |
| InChIKey | NCIDSYQHXSQCTC-YLARQQNOSA-N |
| XLogP | 13.46 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 31 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 846.03 |
| LogP ≤ 5 | 13.46 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|