C26H54O4Si2 — CID 10896223
methyl (2R,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enoate (PubChem CID 10896223) has the molecular formula C26H54O4Si2 and a molecular weight of 486.89 g/mol. Its IUPAC name is methyl (2R,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enoate.
| Compound Name | methyl (2R,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enoate |
|---|---|
| PubChem CID | 10896223 |
| Molecular Formula | C26H54O4Si2 |
| Molecular Weight | 486.89 g/mol |
| Exact Mass | 486.36 |
| IUPAC Name | methyl (2R,3S,4S,5S)-5-[tert-butyl(dimethyl)silyl]oxy-2,4-dimethyl-3-tri(propan-2-yl)silyloxyoct-7-enoate |
| SMILES | C=CC[C@H](O[Si](C)(C)C(C)(C)C)[C@H](C)[C@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@@H](C)C(=O)OC |
| InChI | InChI=1S/C26H54O4Si2/c1-16-17-23(29-31(14,15)26(10,11)12)21(8)24(22(9)25(27)28-13)30-32(18(2)3,19(4)5)20(6)7/h16,18-24H,1,17H2,2-15H3/t21-,22+,23-,24-/m0/s1 |
| InChIKey | AJDQTWZIQWWRIT-KIHHCIJBSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.89 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|