C28H54O6Si2 — CID 11191986
diethyl (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,6-bis(ethenyl)octanedioate (PubChem CID 11191986) has the molecular formula C28H54O6Si2 and a molecular weight of 542.91 g/mol. Its IUPAC name is diethyl (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,6-bis(ethenyl)octanedioate.
| Compound Name | diethyl (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,6-bis(ethenyl)octanedioate |
|---|---|
| PubChem CID | 11191986 |
| Molecular Formula | C28H54O6Si2 |
| Molecular Weight | 542.91 g/mol |
| Exact Mass | 542.35 |
| IUPAC Name | diethyl (4S,5S)-4,5-bis[[tert-butyl(dimethyl)silyl]oxy]-3,6-bis(ethenyl)octanedioate |
| SMILES | C=CC(CC(=O)OCC)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](O[Si](C)(C)C(C)(C)C)C(C=C)CC(=O)OCC |
| InChI | InChI=1S/C28H54O6Si2/c1-15-21(19-23(29)31-17-3)25(33-35(11,12)27(5,6)7)26(34-36(13,14)28(8,9)10)22(16-2)20-24(30)32-18-4/h15-16,21-22,25-26H,1-2,17-20H2,3-14H3/t21?,22?,25-,26-/m0/s1 |
| InChIKey | SRXOIFLTSKLIPF-TZYVOJFLSA-N |
| XLogP | 7.28 |
| TPSA | 71.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 542.91 |
| LogP ≤ 5 | 7.28 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|