C30H54O7Si — CID 135025521
(4S,5R)-5-[(1R,2S)-1-(methoxymethoxy)-2-methylbut-3-enyl]-4-[[(2R,3R,6R)-6-[(2S)-2-methoxypent-4-en-2-yl]-3-methyl-3-triethylsilyloxyoxan-2-yl]methyl]oxolan-2-one (PubChem CID 135025521) has the molecular formula C30H54O7Si and a molecular weight of 554.84 g/mol. Its IUPAC name is (4S,5R)-5-[(1R,2S)-1-(methoxymethoxy)-2-methylbut-3-enyl]-4-[[(2R,3R,6R)-6-[(2S)-2-methoxypent-4-en-2-yl]-3-methyl-3-triethylsilyloxyoxan-2-yl]methyl]oxolan-2-one.
| Compound Name | (4S,5R)-5-[(1R,2S)-1-(methoxymethoxy)-2-methylbut-3-enyl]-4-[[(2R,3R,6R)-6-[(2S)-2-methoxypent-4-en-2-yl]-3-methyl-3-triethylsilyloxyoxan-2-yl]methyl]oxolan-2-one |
|---|---|
| PubChem CID | 135025521 |
| Molecular Formula | C30H54O7Si |
| Molecular Weight | 554.84 g/mol |
| Exact Mass | 554.36 |
| IUPAC Name | (4S,5R)-5-[(1R,2S)-1-(methoxymethoxy)-2-methylbut-3-enyl]-4-[[(2R,3R,6R)-6-[(2S)-2-methoxypent-4-en-2-yl]-3-methyl-3-triethylsilyloxyoxan-2-yl]methyl]oxolan-2-one |
| SMILES | C=CC[C@](C)(OC)[C@H]1CC[C@@](C)(O[Si](CC)(CC)CC)[C@@H](C[C@H]2CC(=O)O[C@H]2[C@H](OCOC)[C@@H](C)C=C)O1 |
| InChI | InChI=1S/C30H54O7Si/c1-11-17-29(7,33-10)24-16-18-30(8,37-38(13-3,14-4)15-5)25(35-24)19-23-20-26(31)36-28(23)27(22(6)12-2)34-21-32-9/h11-12,22-25,27-28H,1-2,13-21H2,3-10H3/t22-,23-,24+,25+,27+,28+,29-,30+/m0/s1 |
| InChIKey | FCCXGSFYYXVTGI-RMCQXYTOSA-N |
| XLogP | 6.43 |
| TPSA | 72.45 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 38 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 554.84 |
| LogP ≤ 5 | 6.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|