C33H62O8Si — CID 71480155
tert-butyl 2-[(1R,5S)-5-[(1R,2R,3S,7S)-3-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate (PubChem CID 71480155) has the molecular formula C33H62O8Si and a molecular weight of 614.94 g/mol. Its IUPAC name is tert-butyl 2-[(1R,5S)-5-[(1R,2R,3S,7S)-3-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R,3S,7S)-3-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 71480155 |
| Molecular Formula | C33H62O8Si |
| Molecular Weight | 614.94 g/mol |
| Exact Mass | 614.42 |
| IUPAC Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R,3S,7S)-3-acetyloxy-1-[tert-butyl(dimethyl)silyl]oxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CC[C@@H](CCC[C@H](OC(C)=O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=C[C@H]1CC(=O)OC(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C33H62O8Si/c1-13-27(38-23-37-21-20-36-10)17-15-19-29(39-25(3)34)24(2)31(41-42(11,12)33(7,8)9)28-18-14-16-26(28)22-30(35)40-32(4,5)6/h14,16,24,26-29,31H,13,15,17-23H2,1-12H3/t24-,26+,27+,28+,29+,31+/m1/s1 |
| InChIKey | YCNHTVHYHGSEPD-WWJYDQNRSA-N |
| XLogP | 7.45 |
| TPSA | 89.52 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 42 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 614.94 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|