C30H54O8Si — CID 10099551
methyl (2S,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoate (PubChem CID 10099551) has the molecular formula C30H54O8Si and a molecular weight of 570.84 g/mol. Its IUPAC name is methyl (2S,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoate.
| Compound Name | methyl (2S,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoate |
|---|---|
| PubChem CID | 10099551 |
| Molecular Formula | C30H54O8Si |
| Molecular Weight | 570.84 g/mol |
| Exact Mass | 570.36 |
| IUPAC Name | methyl (2S,3S)-2-[(1S,3aR,4S,6S,8aR)-4-[tert-butyl(dimethyl)silyl]oxy-1-(2-methoxyethoxymethoxy)-1,2,3,3a,4,5,6,8a-octahydroazulen-6-yl]-5-(1,3-dioxolan-2-yl)-3-methylpentanoate |
| SMILES | COCCOCO[C@H]1CC[C@@H]2[C@H]1C=C[C@@H]([C@@H](C(=O)OC)[C@@H](C)CCC1OCCO1)C[C@@H]2O[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C30H54O8Si/c1-21(9-14-27-35-17-18-36-27)28(29(31)33-6)22-10-11-23-24(12-13-25(23)37-20-34-16-15-32-5)26(19-22)38-39(7,8)30(2,3)4/h10-11,21-28H,9,12-20H2,1-8H3/t21-,22+,23+,24+,25-,26-,28-/m0/s1 |
| InChIKey | SGGQEIRLHINYHG-IZRIHKSQSA-N |
| XLogP | 5.56 |
| TPSA | 81.68 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.84 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|