C31H60O7Si — CID 71480065
tert-butyl 2-[(1R,5S)-5-[(1R,2R,3R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate (PubChem CID 71480065) has the molecular formula C31H60O7Si and a molecular weight of 572.90 g/mol. Its IUPAC name is tert-butyl 2-[(1R,5S)-5-[(1R,2R,3R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R,3R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 71480065 |
| Molecular Formula | C31H60O7Si |
| Molecular Weight | 572.90 g/mol |
| Exact Mass | 572.41 |
| IUPAC Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R,3R,7S)-1-[tert-butyl(dimethyl)silyl]oxy-3-hydroxy-7-(2-methoxyethoxymethoxy)-2-methylnonyl]cyclopent-2-en-1-yl]acetate |
| SMILES | CC[C@@H](CCC[C@@H](O)[C@@H](C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=C[C@H]1CC(=O)OC(C)(C)C)OCOCCOC |
| InChI | InChI=1S/C31H60O7Si/c1-12-25(36-22-35-20-19-34-9)16-14-18-27(32)23(2)29(38-39(10,11)31(6,7)8)26-17-13-15-24(26)21-28(33)37-30(3,4)5/h13,15,23-27,29,32H,12,14,16-22H2,1-11H3/t23-,24+,25+,26+,27-,29+/m1/s1 |
| InChIKey | WGMJLALWAYEKON-VKPSHQAOSA-N |
| XLogP | 6.88 |
| TPSA | 83.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 572.90 |
| LogP ≤ 5 | 6.88 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|