C27H54O4Si2 — CID 71479945
tert-butyl 2-[(1R,5S)-5-[(1R,2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropyl]cyclopent-2-en-1-yl]acetate (PubChem CID 71479945) has the molecular formula C27H54O4Si2 and a molecular weight of 498.90 g/mol. Its IUPAC name is tert-butyl 2-[(1R,5S)-5-[(1R,2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropyl]cyclopent-2-en-1-yl]acetate.
| Compound Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropyl]cyclopent-2-en-1-yl]acetate |
|---|---|
| PubChem CID | 71479945 |
| Molecular Formula | C27H54O4Si2 |
| Molecular Weight | 498.90 g/mol |
| Exact Mass | 498.36 |
| IUPAC Name | tert-butyl 2-[(1R,5S)-5-[(1R,2R)-1,3-bis[[tert-butyl(dimethyl)silyl]oxy]-2-methylpropyl]cyclopent-2-en-1-yl]acetate |
| SMILES | C[C@H](CO[Si](C)(C)C(C)(C)C)[C@H](O[Si](C)(C)C(C)(C)C)[C@H]1CC=C[C@H]1CC(=O)OC(C)(C)C |
| InChI | InChI=1S/C27H54O4Si2/c1-20(19-29-32(11,12)26(5,6)7)24(31-33(13,14)27(8,9)10)22-17-15-16-21(22)18-23(28)30-25(2,3)4/h15-16,20-22,24H,17-19H2,1-14H3/t20-,21+,22+,24+/m1/s1 |
| InChIKey | JQYCUZSNFCTKQC-VCHRRKICSA-N |
| XLogP | 7.96 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 498.90 |
| LogP ≤ 5 | 7.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|