C29H54O6Si — CID 91066521
methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate (PubChem CID 91066521) has the molecular formula C29H54O6Si and a molecular weight of 526.83 g/mol. Its IUPAC name is methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate.
| Compound Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
|---|---|
| PubChem CID | 91066521 |
| Molecular Formula | C29H54O6Si |
| Molecular Weight | 526.83 g/mol |
| Exact Mass | 526.37 |
| IUPAC Name | methyl 7-[(1R,2R,3R,5S)-3-[tert-butyl(dimethyl)silyl]oxy-5-hydroxy-2-[2-(2-pentyl-1,3-dioxolan-2-yl)ethyl]cyclopentyl]hept-5-enoate |
| SMILES | CCCCCC1(CC[C@@H]2[C@@H](CC=CCCCC(=O)OC)[C@@H](O)C[C@H]2O[Si](C)(C)C(C)(C)C)OCCO1 |
| InChI | InChI=1S/C29H54O6Si/c1-8-9-14-18-29(33-20-21-34-29)19-17-24-23(15-12-10-11-13-16-27(31)32-5)25(30)22-26(24)35-36(6,7)28(2,3)4/h10,12,23-26,30H,8-9,11,13-22H2,1-7H3/t23-,24-,25+,26-/m1/s1 |
| InChIKey | IPFNQNICUGMEQL-FXSWLTOZSA-N |
| XLogP | 6.77 |
| TPSA | 74.22 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 15 |
| Heavy Atoms | 36 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.83 |
| LogP ≤ 5 | 6.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|