C35H62O5Si — CID 134878731
(6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(E,2S)-4-methyl-6-[(7R,9S)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]hex-4-en-2-yl]-1-oxacyclododec-9-en-2-one (PubChem CID 134878731) has the molecular formula C35H62O5Si and a molecular weight of 590.96 g/mol. Its IUPAC name is (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(E,2S)-4-methyl-6-[(7R,9S)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]hex-4-en-2-yl]-1-oxacyclododec-9-en-2-one.
| Compound Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(E,2S)-4-methyl-6-[(7R,9S)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]hex-4-en-2-yl]-1-oxacyclododec-9-en-2-one |
|---|---|
| PubChem CID | 134878731 |
| Molecular Formula | C35H62O5Si |
| Molecular Weight | 590.96 g/mol |
| Exact Mass | 590.44 |
| IUPAC Name | (6S,7S,9E,12R)-6-[tert-butyl(dimethyl)silyl]oxy-7,9-dimethyl-12-[(E,2S)-4-methyl-6-[(7R,9S)-7-methyl-6,10-dioxaspiro[4.5]decan-9-yl]hex-4-en-2-yl]-1-oxacyclododec-9-en-2-one |
| SMILES | C/C1=C\C[C@H]([C@@H](C)C/C(C)=C/C[C@H]2C[C@@H](C)OC3(CCCC3)O2)OC(=O)CCC[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C)C1 |
| InChI | InChI=1S/C35H62O5Si/c1-25(16-18-30-24-29(5)38-35(39-30)20-11-12-21-35)22-27(3)31-19-17-26(2)23-28(4)32(14-13-15-33(36)37-31)40-41(9,10)34(6,7)8/h16-17,27-32H,11-15,18-24H2,1-10H3/b25-16+,26-17+/t27-,28-,29+,30-,31+,32-/m0/s1 |
| InChIKey | YMSCUKGURKIUNS-STPQIPJSSA-N |
| XLogP | 9.66 |
| TPSA | 53.99 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 590.96 |
| LogP ≤ 5 | 9.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|