C32H58O6Si — CID 15953255
ethyl 2-[(2R,5S)-5-[(1R,2R,3R,6E)-1-(methoxymethoxy)-3,9-dimethyl-5-methylidene-2-tri(propan-2-yl)silyloxydeca-6,9-dienyl]oxolan-2-yl]acetate (PubChem CID 15953255) has the molecular formula C32H58O6Si and a molecular weight of 566.90 g/mol. Its IUPAC name is ethyl 2-[(2R,5S)-5-[(1R,2R,3R,6E)-1-(methoxymethoxy)-3,9-dimethyl-5-methylidene-2-tri(propan-2-yl)silyloxydeca-6,9-dienyl]oxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R,6E)-1-(methoxymethoxy)-3,9-dimethyl-5-methylidene-2-tri(propan-2-yl)silyloxydeca-6,9-dienyl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 15953255 |
| Molecular Formula | C32H58O6Si |
| Molecular Weight | 566.90 g/mol |
| Exact Mass | 566.40 |
| IUPAC Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R,6E)-1-(methoxymethoxy)-3,9-dimethyl-5-methylidene-2-tri(propan-2-yl)silyloxydeca-6,9-dienyl]oxolan-2-yl]acetate |
| SMILES | C=C(C)C/C=C/C(=C)C[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OCOC)[C@@H]1CC[C@H](CC(=O)OCC)O1 |
| InChI | InChI=1S/C32H58O6Si/c1-13-35-30(33)20-28-17-18-29(37-28)32(36-21-34-12)31(27(11)19-26(10)16-14-15-22(2)3)38-39(23(4)5,24(6)7)25(8)9/h14,16,23-25,27-29,31-32H,2,10,13,15,17-21H2,1,3-9,11-12H3/b16-14+/t27-,28-,29+,31-,32-/m1/s1 |
| InChIKey | AMGYCLNQXINCQJ-WDYISUORSA-N |
| XLogP | 8.14 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 19 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.90 |
| LogP ≤ 5 | 8.14 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|