C28H52O6Si — CID 15953256
ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-5-methylidene-2-tri(propan-2-yl)silyloxyhept-6-enyl]oxolan-2-yl]acetate (PubChem CID 15953256) has the molecular formula C28H52O6Si and a molecular weight of 512.80 g/mol. Its IUPAC name is ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-5-methylidene-2-tri(propan-2-yl)silyloxyhept-6-enyl]oxolan-2-yl]acetate.
| Compound Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-5-methylidene-2-tri(propan-2-yl)silyloxyhept-6-enyl]oxolan-2-yl]acetate |
|---|---|
| PubChem CID | 15953256 |
| Molecular Formula | C28H52O6Si |
| Molecular Weight | 512.80 g/mol |
| Exact Mass | 512.35 |
| IUPAC Name | ethyl 2-[(2R,5S)-5-[(1R,2R,3R)-1-(methoxymethoxy)-3-methyl-5-methylidene-2-tri(propan-2-yl)silyloxyhept-6-enyl]oxolan-2-yl]acetate |
| SMILES | C=CC(=C)C[C@@H](C)[C@@H](O[Si](C(C)C)(C(C)C)C(C)C)[C@H](OCOC)[C@@H]1CC[C@H](CC(=O)OCC)O1 |
| InChI | InChI=1S/C28H52O6Si/c1-12-22(9)16-23(10)27(34-35(19(3)4,20(5)6)21(7)8)28(32-18-30-11)25-15-14-24(33-25)17-26(29)31-13-2/h12,19-21,23-25,27-28H,1,9,13-18H2,2-8,10-11H3/t23-,24-,25+,27-,28-/m1/s1 |
| InChIKey | DXKVTDFWIAIIFC-FOJJTFNQSA-N |
| XLogP | 6.81 |
| TPSA | 63.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 17 |
| Heavy Atoms | 35 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 512.80 |
| LogP ≤ 5 | 6.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'polyene', 'substructure': 'N/A'} |
|---|